C29H28F2N4O4 — CID 126507048
(16S)-N-[(2,4-difluorophenyl)methyl]-2,5-dioxo-4-phenylmethoxy-1,8,11-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,6-diene-6-carboxamide (PubChem CID 126507048) has the molecular formula C29H28F2N4O4 and a molecular weight of 534.56 g/mol. Its IUPAC name is (16S)-N-[(2,4-difluorophenyl)methyl]-2,5-dioxo-4-phenylmethoxy-1,8,11-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,6-diene-6-carboxamide.
| Compound Name | (16S)-N-[(2,4-difluorophenyl)methyl]-2,5-dioxo-4-phenylmethoxy-1,8,11-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,6-diene-6-carboxamide |
|---|---|
| PubChem CID | 126507048 |
| Molecular Formula | C29H28F2N4O4 |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | (16S)-N-[(2,4-difluorophenyl)methyl]-2,5-dioxo-4-phenylmethoxy-1,8,11-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,6-diene-6-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1F)c1cn2c(c(OCc3ccccc3)c1=O)C(=O)N1C[C@@H]3CCCCN3C1C2 |
| InChI | InChI=1S/C29H28F2N4O4/c30-20-10-9-19(23(31)12-20)13-32-28(37)22-15-33-16-24-34-11-5-4-8-21(34)14-35(24)29(38)25(33)27(26(22)36)39-17-18-6-2-1-3-7-18/h1-3,6-7,9-10,12,15,21,24H,4-5,8,11,13-14,16-17H2,(H,32,37)/t21-,24?/m0/s1 |
| InChIKey | FADPXJMXRMRWRT-XEGCMXMBSA-N |
| XLogP | 3.29 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |