C24H29N4O4P — CID 129153400
(10S,16S)-N-[(2E,4Z)-2-ethenylhepta-2,4,6-trienyl]-2,5-dioxo-4-phosphanyloxy-1,8,11-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,6-diene-6-carboxamide (PubChem CID 129153400) has the molecular formula C24H29N4O4P and a molecular weight of 468.49 g/mol. Its IUPAC name is (10S,16S)-N-[(2E,4Z)-2-ethenylhepta-2,4,6-trienyl]-2,5-dioxo-4-phosphanyloxy-1,8,11-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,6-diene-6-carboxamide.
| Compound Name | (10S,16S)-N-[(2E,4Z)-2-ethenylhepta-2,4,6-trienyl]-2,5-dioxo-4-phosphanyloxy-1,8,11-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,6-diene-6-carboxamide |
|---|---|
| PubChem CID | 129153400 |
| Molecular Formula | C24H29N4O4P |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | (10S,16S)-N-[(2E,4Z)-2-ethenylhepta-2,4,6-trienyl]-2,5-dioxo-4-phosphanyloxy-1,8,11-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,6-diene-6-carboxamide |
| SMILES | C=C/C=C\C=C(/C=C)CNC(=O)c1cn2c(c(OP)c1=O)C(=O)N1C[C@@H]3CCCCN3[C@@H]1C2 |
| InChI | InChI=1S/C24H29N4O4P/c1-3-5-6-9-16(4-2)12-25-23(30)18-14-26-15-19-27-11-8-7-10-17(27)13-28(19)24(31)20(26)22(32-33)21(18)29/h3-6,9,14,17,19H,1-2,7-8,10-13,15,33H2,(H,25,30)/b6-5-,16-9+/t17-,19-/m0/s1 |
| InChIKey | IQCWTYLOMGLKNJ-YEYIUCBGSA-N |
| XLogP | 2.25 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|