C22H27N4O4P — CID 129153403
(10R,15S)-N-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2,5-dioxo-4-phosphanyloxy-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-diene-6-carboxamide (PubChem CID 129153403) has the molecular formula C22H27N4O4P and a molecular weight of 442.46 g/mol. Its IUPAC name is (10R,15S)-N-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2,5-dioxo-4-phosphanyloxy-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-diene-6-carboxamide.
| Compound Name | (10R,15S)-N-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2,5-dioxo-4-phosphanyloxy-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-diene-6-carboxamide |
|---|---|
| PubChem CID | 129153403 |
| Molecular Formula | C22H27N4O4P |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | (10R,15S)-N-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-2,5-dioxo-4-phosphanyloxy-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-diene-6-carboxamide |
| SMILES | C=C/C(=C\C=C/C)CNC(=O)c1cn2c(c(OP)c1=O)C(=O)N1C[C@@H]3CCCN3[C@H]1C2 |
| InChI | InChI=1S/C22H27N4O4P/c1-3-5-7-14(4-2)10-23-21(28)16-12-24-13-17-25-9-6-8-15(25)11-26(17)22(29)18(24)20(30-31)19(16)27/h3-5,7,12,15,17H,2,6,8-11,13,31H2,1H3,(H,23,28)/b5-3-,14-7+/t15-,17+/m0/s1 |
| InChIKey | FWVDUBVCDVXDQO-LQEFKDDSSA-N |
| XLogP | 1.70 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|