C22H28N3O5P — CID 130276740
(1R,15R)-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]-6,9-dioxo-7-phosphanyloxy-17-oxa-3,10-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-4,7-diene-5-carboxamide (PubChem CID 130276740) has the molecular formula C22H28N3O5P and a molecular weight of 445.46 g/mol. Its IUPAC name is (1R,15R)-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]-6,9-dioxo-7-phosphanyloxy-17-oxa-3,10-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-4,7-diene-5-carboxamide.
| Compound Name | (1R,15R)-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]-6,9-dioxo-7-phosphanyloxy-17-oxa-3,10-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-4,7-diene-5-carboxamide |
|---|---|
| PubChem CID | 130276740 |
| Molecular Formula | C22H28N3O5P |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | (1R,15R)-N-[(2E,4Z)-2-methylhexa-2,4-dienyl]-6,9-dioxo-7-phosphanyloxy-17-oxa-3,10-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-4,7-diene-5-carboxamide |
| SMILES | C/C=C\C=C(/C)CNC(=O)c1cn2c(c(OP)c1=O)C(=O)N1C3CCC[C@H]3CO[C@@H]1C2 |
| InChI | InChI=1S/C22H28N3O5P/c1-3-4-6-13(2)9-23-21(27)15-10-24-11-17-25(16-8-5-7-14(16)12-29-17)22(28)18(24)20(30-31)19(15)26/h3-4,6,10,14,16-17H,5,7-9,11-12,31H2,1-2H3,(H,23,27)/b4-3-,13-6+/t14-,16?,17+/m0/s1 |
| InChIKey | INKMLPFHGKTLSY-JWNIGVJUSA-N |
| XLogP | 2.25 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|