C31H28F2N4O9 — CID 58277224
[(10S,15R)-6-[3-(2,4-difluorophenyl)propanoyl]-2,5-dioxo-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-dien-4-yl]oxymethyl (2-methyl-4-nitrophenyl) carbonate (PubChem CID 58277224) has the molecular formula C31H28F2N4O9 and a molecular weight of 638.58 g/mol. Its IUPAC name is [(10S,15R)-6-[3-(2,4-difluorophenyl)propanoyl]-2,5-dioxo-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-dien-4-yl]oxymethyl (2-methyl-4-nitrophenyl) carbonate.
| Compound Name | [(10S,15R)-6-[3-(2,4-difluorophenyl)propanoyl]-2,5-dioxo-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-dien-4-yl]oxymethyl (2-methyl-4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 58277224 |
| Molecular Formula | C31H28F2N4O9 |
| Molecular Weight | 638.58 g/mol |
| Exact Mass | 638.18 |
| IUPAC Name | [(10S,15R)-6-[3-(2,4-difluorophenyl)propanoyl]-2,5-dioxo-1,8,11-triazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,6-dien-4-yl]oxymethyl (2-methyl-4-nitrophenyl) carbonate |
| SMILES | Cc1cc([N+](=O)[O-])ccc1OC(=O)OCOc1c2n(cc(C(=O)CCc3ccc(F)cc3F)c1=O)C[C@@H]1N(C[C@H]3CCCN31)C2=O |
| InChI | InChI=1S/C31H28F2N4O9/c1-17-11-20(37(42)43)7-9-25(17)46-31(41)45-16-44-29-27-30(40)36-13-21-3-2-10-35(21)26(36)15-34(27)14-22(28(29)39)24(38)8-5-18-4-6-19(32)12-23(18)33/h4,6-7,9,11-12,14,21,26H,2-3,5,8,10,13,15-16H2,1H3/t21-,26+/m1/s1 |
| InChIKey | SAPUMQKJKWMXOD-RLWLMLJZSA-N |
| XLogP | 3.97 |
| TPSA | 150.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|