C21H23F2N3O5 — CID 144787740
(3S)-N-[(2,4-difluorophenyl)methyl]-3,9-dimethoxy-1,8-dioxo-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide (PubChem CID 144787740) has the molecular formula C21H23F2N3O5 and a molecular weight of 435.43 g/mol. Its IUPAC name is (3S)-N-[(2,4-difluorophenyl)methyl]-3,9-dimethoxy-1,8-dioxo-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide.
| Compound Name | (3S)-N-[(2,4-difluorophenyl)methyl]-3,9-dimethoxy-1,8-dioxo-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 144787740 |
| Molecular Formula | C21H23F2N3O5 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | (3S)-N-[(2,4-difluorophenyl)methyl]-3,9-dimethoxy-1,8-dioxo-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide |
| SMILES | COc1c2n(cc(C(=O)NCc3ccc(F)cc3F)c1=O)C[C@H](OC)N(C(C)C)C2=O |
| InChI | InChI=1S/C21H23F2N3O5/c1-11(2)26-16(30-3)10-25-9-14(18(27)19(31-4)17(25)21(26)29)20(28)24-8-12-5-6-13(22)7-15(12)23/h5-7,9,11,16H,8,10H2,1-4H3,(H,24,28)/t16-/m0/s1 |
| InChIKey | QDWMYBMJRBYJRY-INIZCTEOSA-N |
| XLogP | 1.90 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |