C24H25F2N2O5+ — CID 140841367
(6aR,11aR)-N-[(2,4-difluorophenyl)methyl]-6a-hydroxy-1-methoxy-11a-methyl-2,12-dioxo-6,7,8,9,10,11-hexahydrocyclohepta[b]quinolizin-9-ylium-3-carboxamide (PubChem CID 140841367) has the molecular formula C24H25F2N2O5+ and a molecular weight of 459.47 g/mol. Its IUPAC name is (6aR,11aR)-N-[(2,4-difluorophenyl)methyl]-6a-hydroxy-1-methoxy-11a-methyl-2,12-dioxo-6,7,8,9,10,11-hexahydrocyclohepta[b]quinolizin-9-ylium-3-carboxamide.
| Compound Name | (6aR,11aR)-N-[(2,4-difluorophenyl)methyl]-6a-hydroxy-1-methoxy-11a-methyl-2,12-dioxo-6,7,8,9,10,11-hexahydrocyclohepta[b]quinolizin-9-ylium-3-carboxamide |
|---|---|
| PubChem CID | 140841367 |
| Molecular Formula | C24H25F2N2O5+ |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | (6aR,11aR)-N-[(2,4-difluorophenyl)methyl]-6a-hydroxy-1-methoxy-11a-methyl-2,12-dioxo-6,7,8,9,10,11-hexahydrocyclohepta[b]quinolizin-9-ylium-3-carboxamide |
| SMILES | COc1c2n(cc(C(=O)NCc3ccc(F)cc3F)c1=O)C[C@@]1(O)CC[CH+]CC[C@@]1(C)C2=O |
| InChI | InChI=1S/C24H24F2N2O5/c1-23-8-4-3-5-9-24(23,32)13-28-12-16(19(29)20(33-2)18(28)21(23)30)22(31)27-11-14-6-7-15(25)10-17(14)26/h3,6-7,10,12,32H,4-5,8-9,11,13H2,1-2H3/p+1/t23-,24-/m0/s1 |
| InChIKey | ODSLZOQNZGVVEA-ZEQRLZLVSA-O |
| XLogP | 2.78 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|