C22H24F2N2O6 — CID 122471196
(7R,8R)-N-[(2,4-difluorophenyl)methyl]-1,7-dimethoxy-8-(methoxymethyl)-8-methyl-2,9-dioxo-6,7-dihydroquinolizine-3-carboxamide (PubChem CID 122471196) has the molecular formula C22H24F2N2O6 and a molecular weight of 450.44 g/mol. Its IUPAC name is (7R,8R)-N-[(2,4-difluorophenyl)methyl]-1,7-dimethoxy-8-(methoxymethyl)-8-methyl-2,9-dioxo-6,7-dihydroquinolizine-3-carboxamide.
| Compound Name | (7R,8R)-N-[(2,4-difluorophenyl)methyl]-1,7-dimethoxy-8-(methoxymethyl)-8-methyl-2,9-dioxo-6,7-dihydroquinolizine-3-carboxamide |
|---|---|
| PubChem CID | 122471196 |
| Molecular Formula | C22H24F2N2O6 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | (7R,8R)-N-[(2,4-difluorophenyl)methyl]-1,7-dimethoxy-8-(methoxymethyl)-8-methyl-2,9-dioxo-6,7-dihydroquinolizine-3-carboxamide |
| SMILES | COC[C@@]1(C)C(=O)c2c(OC)c(=O)c(C(=O)NCc3ccc(F)cc3F)cn2C[C@@H]1OC |
| InChI | InChI=1S/C22H24F2N2O6/c1-22(11-30-2)16(31-3)10-26-9-14(18(27)19(32-4)17(26)20(22)28)21(29)25-8-12-5-6-13(23)7-15(12)24/h5-7,9,16H,8,10-11H2,1-4H3,(H,25,29)/t16-,22+/m0/s1 |
| InChIKey | GWUHKUQFUOURNH-KSFYIVLOSA-N |
| XLogP | 1.93 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |