C21H22F2N2O5 — CID 155273838
N-[(2,4-difluorophenyl)methyl]-1-hydroxy-8-(2-methoxyethyl)-8-methyl-2,9-dioxo-6,7-dihydroquinolizine-3-carboxamide (PubChem CID 155273838) has the molecular formula C21H22F2N2O5 and a molecular weight of 420.41 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-1-hydroxy-8-(2-methoxyethyl)-8-methyl-2,9-dioxo-6,7-dihydroquinolizine-3-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-1-hydroxy-8-(2-methoxyethyl)-8-methyl-2,9-dioxo-6,7-dihydroquinolizine-3-carboxamide |
|---|---|
| PubChem CID | 155273838 |
| Molecular Formula | C21H22F2N2O5 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-1-hydroxy-8-(2-methoxyethyl)-8-methyl-2,9-dioxo-6,7-dihydroquinolizine-3-carboxamide |
| SMILES | COCCC1(C)CCn2cc(C(=O)NCc3ccc(F)cc3F)c(=O)c(O)c2C1=O |
| InChI | InChI=1S/C21H22F2N2O5/c1-21(6-8-30-2)5-7-25-11-14(17(26)18(27)16(25)19(21)28)20(29)24-10-12-3-4-13(22)9-15(12)23/h3-4,9,11,27H,5-8,10H2,1-2H3,(H,24,29) |
| InChIKey | WFGTVPQLNAWVQL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |