C20H20F2N4O6S — CID 155145760
N-[(2,4-difluorophenyl)methyl]-6-hydroxy-12-methylsulfonyl-5,8-dioxo-2,9,12-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide (PubChem CID 155145760) has the molecular formula C20H20F2N4O6S and a molecular weight of 482.47 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-6-hydroxy-12-methylsulfonyl-5,8-dioxo-2,9,12-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-6-hydroxy-12-methylsulfonyl-5,8-dioxo-2,9,12-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 155145760 |
| Molecular Formula | C20H20F2N4O6S |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-6-hydroxy-12-methylsulfonyl-5,8-dioxo-2,9,12-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
| SMILES | CS(=O)(=O)N1CCN2CC(C1)n1cc(C(=O)NCc3ccc(F)cc3F)c(=O)c(O)c1C2=O |
| InChI | InChI=1S/C20H20F2N4O6S/c1-33(31,32)25-5-4-24-8-13(9-25)26-10-14(17(27)18(28)16(26)20(24)30)19(29)23-7-11-2-3-12(21)6-15(11)22/h2-3,6,10,13,28H,4-5,7-9H2,1H3,(H,23,29) |
| InChIKey | CMGSFRPHYDKWHM-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 129.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |