C21H23F2N3O4 — CID 155699908
N-[(2,4-difluorophenyl)methyl]-6-formyl-5-hydroxy-1-(1-methylazepan-3-yl)-4-oxopyridine-3-carboxamide (PubChem CID 155699908) has the molecular formula C21H23F2N3O4 and a molecular weight of 419.43 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-6-formyl-5-hydroxy-1-(1-methylazepan-3-yl)-4-oxopyridine-3-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-6-formyl-5-hydroxy-1-(1-methylazepan-3-yl)-4-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 155699908 |
| Molecular Formula | C21H23F2N3O4 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-6-formyl-5-hydroxy-1-(1-methylazepan-3-yl)-4-oxopyridine-3-carboxamide |
| SMILES | CN1CCCCC(n2cc(C(=O)NCc3ccc(F)cc3F)c(=O)c(O)c2C=O)C1 |
| InChI | InChI=1S/C21H23F2N3O4/c1-25-7-3-2-4-15(10-25)26-11-16(19(28)20(29)18(26)12-27)21(30)24-9-13-5-6-14(22)8-17(13)23/h5-6,8,11-12,15,29H,2-4,7,9-10H2,1H3,(H,24,30) |
| InChIKey | JSTPNXPYXVGOQS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|