C23H27F2N3O4 — CID 167114047
N-[(2,4-difluorophenyl)methyl]-1-(4-ethyl-1-methylazepan-3-yl)-6-formyl-5-hydroxy-4-oxopyridine-3-carboxamide (PubChem CID 167114047) has the molecular formula C23H27F2N3O4 and a molecular weight of 447.48 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-1-(4-ethyl-1-methylazepan-3-yl)-6-formyl-5-hydroxy-4-oxopyridine-3-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-1-(4-ethyl-1-methylazepan-3-yl)-6-formyl-5-hydroxy-4-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 167114047 |
| Molecular Formula | C23H27F2N3O4 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-1-(4-ethyl-1-methylazepan-3-yl)-6-formyl-5-hydroxy-4-oxopyridine-3-carboxamide |
| SMILES | CCC1CCCN(C)CC1n1cc(C(=O)NCc2ccc(F)cc2F)c(=O)c(O)c1C=O |
| InChI | InChI=1S/C23H27F2N3O4/c1-3-14-5-4-8-27(2)12-19(14)28-11-17(21(30)22(31)20(28)13-29)23(32)26-10-15-6-7-16(24)9-18(15)25/h6-7,9,11,13-14,19,31H,3-5,8,10,12H2,1-2H3,(H,26,32) |
| InChIKey | WWPLXLFFQVVXRY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|