C25H26F2N6O5S — CID 137167216
[2-(2,4-difluorophenyl)ethanimidoyl] 6-[[1,3-dihydroxy-5-(methylamino)-2,4,6,7-tetrahydroisoindol-5-yl]-methylcarbamoyl]-5-hydroxy-4-oxo-1H-pyridine-3-carboximidothioate (PubChem CID 137167216) has the molecular formula C25H26F2N6O5S and a molecular weight of 560.58 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)ethanimidoyl] 6-[[1,3-dihydroxy-5-(methylamino)-2,4,6,7-tetrahydroisoindol-5-yl]-methylcarbamoyl]-5-hydroxy-4-oxo-1H-pyridine-3-carboximidothioate.
| Compound Name | [2-(2,4-difluorophenyl)ethanimidoyl] 6-[[1,3-dihydroxy-5-(methylamino)-2,4,6,7-tetrahydroisoindol-5-yl]-methylcarbamoyl]-5-hydroxy-4-oxo-1H-pyridine-3-carboximidothioate |
|---|---|
| PubChem CID | 137167216 |
| Molecular Formula | C25H26F2N6O5S |
| Molecular Weight | 560.58 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | [2-(2,4-difluorophenyl)ethanimidoyl] 6-[[1,3-dihydroxy-5-(methylamino)-2,4,6,7-tetrahydroisoindol-5-yl]-methylcarbamoyl]-5-hydroxy-4-oxo-1H-pyridine-3-carboximidothioate |
| SMILES | [H]/N=C(\S/C(Cc1ccc(F)cc1F)=N/[H])c1c[nH]c(C(=O)N(C)C2(NC)CCc3c(O)[nH]c(O)c3C2)c(O)c1=O |
| InChI | InChI=1S/C25H26F2N6O5S/c1-30-25(6-5-13-14(9-25)23(37)32-22(13)36)33(2)24(38)18-20(35)19(34)15(10-31-18)21(29)39-17(28)7-11-3-4-12(26)8-16(11)27/h3-4,8,10,28-30,32,35-37H,5-7,9H2,1-2H3,(H,31,34)/b28-17+,29-21- |
| InChIKey | JHGQSPGMTPPACZ-USQFPBAQSA-N |
| XLogP | 2.55 |
| TPSA | 189.38 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.58 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|