C28H39FN6O3S — CID 144651391
N-[4-(cyclopropylamino)-1-(methylamino)cyclohexyl]-N-ethylformamide;[2-(4-fluorophenyl)ethanimidoyl] 5-hydroxy-6-methyl-4-oxo-1H-pyridine-3-carboximidothioate (PubChem CID 144651391) has the molecular formula C28H39FN6O3S and a molecular weight of 558.72 g/mol. Its IUPAC name is N-[4-(cyclopropylamino)-1-(methylamino)cyclohexyl]-N-ethylformamide;[2-(4-fluorophenyl)ethanimidoyl] 5-hydroxy-6-methyl-4-oxo-1H-pyridine-3-carboximidothioate.
| Compound Name | N-[4-(cyclopropylamino)-1-(methylamino)cyclohexyl]-N-ethylformamide;[2-(4-fluorophenyl)ethanimidoyl] 5-hydroxy-6-methyl-4-oxo-1H-pyridine-3-carboximidothioate |
|---|---|
| PubChem CID | 144651391 |
| Molecular Formula | C28H39FN6O3S |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | N-[4-(cyclopropylamino)-1-(methylamino)cyclohexyl]-N-ethylformamide;[2-(4-fluorophenyl)ethanimidoyl] 5-hydroxy-6-methyl-4-oxo-1H-pyridine-3-carboximidothioate |
| SMILES | CCN(C=O)C1(NC)CCC(NC2CC2)CC1.[H]/N=C(\S/C(Cc1ccc(F)cc1)=N/[H])c1c[nH]c(C)c(O)c1=O |
| InChI | InChI=1S/C15H14FN3O2S.C13H25N3O/c1-8-13(20)14(21)11(7-19-8)15(18)22-12(17)6-9-2-4-10(16)5-3-9;1-3-16(10-17)13(14-2)8-6-12(7-9-13)15-11-4-5-11/h2-5,7,17-18,20H,6H2,1H3,(H,19,21);10-12,14-15H,3-9H2,1-2H3/b17-12+,18-15-; |
| InChIKey | NNQAECKQHOKKPH-JMLIQKJESA-N |
| XLogP | 3.88 |
| TPSA | 145.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|