C28H41FN6O4S — CID 144651320
[1-amino-2-(4-fluorophenyl)ethyl] 5-hydroxy-6-methyl-4-oxo-1H-pyridine-3-carboximidothioate;(1S)-4-[formyl(methyl)amino]-N,N,2-trimethyl-4-(methylamino)cyclohexane-1-carboxamide (PubChem CID 144651320) has the molecular formula C28H41FN6O4S and a molecular weight of 576.74 g/mol. Its IUPAC name is [1-amino-2-(4-fluorophenyl)ethyl] 5-hydroxy-6-methyl-4-oxo-1H-pyridine-3-carboximidothioate;(1S)-4-[formyl(methyl)amino]-N,N,2-trimethyl-4-(methylamino)cyclohexane-1-carboxamide.
| Compound Name | [1-amino-2-(4-fluorophenyl)ethyl] 5-hydroxy-6-methyl-4-oxo-1H-pyridine-3-carboximidothioate;(1S)-4-[formyl(methyl)amino]-N,N,2-trimethyl-4-(methylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 144651320 |
| Molecular Formula | C28H41FN6O4S |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | [1-amino-2-(4-fluorophenyl)ethyl] 5-hydroxy-6-methyl-4-oxo-1H-pyridine-3-carboximidothioate;(1S)-4-[formyl(methyl)amino]-N,N,2-trimethyl-4-(methylamino)cyclohexane-1-carboxamide |
| SMILES | CNC1(N(C)C=O)CC[C@H](C(=O)N(C)C)C(C)C1.[H]/N=C(\SC(N)Cc1ccc(F)cc1)c1c[nH]c(C)c(O)c1=O |
| InChI | InChI=1S/C15H16FN3O2S.C13H25N3O2/c1-8-13(20)14(21)11(7-19-8)15(18)22-12(17)6-9-2-4-10(16)5-3-9;1-10-8-13(14-2,16(5)9-17)7-6-11(10)12(18)15(3)4/h2-5,7,12,18,20H,6,17H2,1H3,(H,19,21);9-11,14H,6-8H2,1-5H3/b18-15-;/t;10?,11-,13?/m.0/s1 |
| InChIKey | ZSKGBJPTEOVJCP-GGOMFASBSA-N |
| XLogP | 2.63 |
| TPSA | 155.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|