C25H30FN5O5S — CID 139374877
methyl 3-[ethyl(formyl)amino]-3-[[5-[C-[2-(4-fluorophenyl)ethanimidoyl]sulfanylcarbonimidoyl]-3-hydroxy-2-methyl-4-oxo-1-pyridinyl]-methylamino]cyclobutane-1-carboxylate (PubChem CID 139374877) has the molecular formula C25H30FN5O5S and a molecular weight of 531.61 g/mol. Its IUPAC name is methyl 3-[ethyl(formyl)amino]-3-[[5-[C-[2-(4-fluorophenyl)ethanimidoyl]sulfanylcarbonimidoyl]-3-hydroxy-2-methyl-4-oxo-1-pyridinyl]-methylamino]cyclobutane-1-carboxylate.
| Compound Name | methyl 3-[ethyl(formyl)amino]-3-[[5-[C-[2-(4-fluorophenyl)ethanimidoyl]sulfanylcarbonimidoyl]-3-hydroxy-2-methyl-4-oxo-1-pyridinyl]-methylamino]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 139374877 |
| Molecular Formula | C25H30FN5O5S |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | methyl 3-[ethyl(formyl)amino]-3-[[5-[C-[2-(4-fluorophenyl)ethanimidoyl]sulfanylcarbonimidoyl]-3-hydroxy-2-methyl-4-oxo-1-pyridinyl]-methylamino]cyclobutane-1-carboxylate |
| SMILES | [H]/N=C(\S/C(Cc1ccc(F)cc1)=N/[H])c1cn(N(C)C2(N(C=O)CC)CC(C(=O)OC)C2)c(C)c(O)c1=O |
| InChI | InChI=1S/C25H30FN5O5S/c1-5-30(14-32)25(11-17(12-25)24(35)36-4)29(3)31-13-19(22(34)21(33)15(31)2)23(28)37-20(27)10-16-6-8-18(26)9-7-16/h6-9,13-14,17,27-28,33H,5,10-12H2,1-4H3/b27-20+,28-23- |
| InChIKey | RTFIQRARVRUELU-BZUKKUDCSA-N |
| XLogP | 2.61 |
| TPSA | 139.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|