C28H37FN6O4S — CID 139374748
[2-(4-fluorophenyl)ethanimidoyl] 6-[[4-[2-(dimethylamino)-2-oxoethyl]-1-(methylamino)cyclohexyl]-ethylcarbamoyl]-5-hydroxy-4-oxo-1H-pyridine-3-carboximidothioate (PubChem CID 139374748) has the molecular formula C28H37FN6O4S and a molecular weight of 572.71 g/mol. Its IUPAC name is [2-(4-fluorophenyl)ethanimidoyl] 6-[[4-[2-(dimethylamino)-2-oxoethyl]-1-(methylamino)cyclohexyl]-ethylcarbamoyl]-5-hydroxy-4-oxo-1H-pyridine-3-carboximidothioate.
| Compound Name | [2-(4-fluorophenyl)ethanimidoyl] 6-[[4-[2-(dimethylamino)-2-oxoethyl]-1-(methylamino)cyclohexyl]-ethylcarbamoyl]-5-hydroxy-4-oxo-1H-pyridine-3-carboximidothioate |
|---|---|
| PubChem CID | 139374748 |
| Molecular Formula | C28H37FN6O4S |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | [2-(4-fluorophenyl)ethanimidoyl] 6-[[4-[2-(dimethylamino)-2-oxoethyl]-1-(methylamino)cyclohexyl]-ethylcarbamoyl]-5-hydroxy-4-oxo-1H-pyridine-3-carboximidothioate |
| SMILES | [H]/N=C(\S/C(Cc1ccc(F)cc1)=N/[H])c1c[nH]c(C(=O)N(CC)C2(NC)CCC(CC(=O)N(C)C)CC2)c(O)c1=O |
| InChI | InChI=1S/C28H37FN6O4S/c1-5-35(28(32-2)12-10-18(11-13-28)15-22(36)34(3)4)27(39)23-25(38)24(37)20(16-33-23)26(31)40-21(30)14-17-6-8-19(29)9-7-17/h6-9,16,18,30-32,38H,5,10-15H2,1-4H3,(H,33,37)/b30-21+,31-26- |
| InChIKey | XBBDXTCUFVKJMR-YBGKSVCRSA-N |
| XLogP | 3.54 |
| TPSA | 153.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|