C29H32FN5O5S — CID 123345271
[2-(4-fluorophenyl)ethanimidoyl] 15-(ethoxymethyl)-2-ethyl-15-formyl-5-hydroxy-3,6-dioxo-2,9,10-triazapentacyclo[8.7.0.01,13.04,9.011,13]heptadeca-4,7-diene-7-carboximidothioate (PubChem CID 123345271) has the molecular formula C29H32FN5O5S and a molecular weight of 581.67 g/mol. Its IUPAC name is [2-(4-fluorophenyl)ethanimidoyl] 15-(ethoxymethyl)-2-ethyl-15-formyl-5-hydroxy-3,6-dioxo-2,9,10-triazapentacyclo[8.7.0.01,13.04,9.011,13]heptadeca-4,7-diene-7-carboximidothioate.
| Compound Name | [2-(4-fluorophenyl)ethanimidoyl] 15-(ethoxymethyl)-2-ethyl-15-formyl-5-hydroxy-3,6-dioxo-2,9,10-triazapentacyclo[8.7.0.01,13.04,9.011,13]heptadeca-4,7-diene-7-carboximidothioate |
|---|---|
| PubChem CID | 123345271 |
| Molecular Formula | C29H32FN5O5S |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | [2-(4-fluorophenyl)ethanimidoyl] 15-(ethoxymethyl)-2-ethyl-15-formyl-5-hydroxy-3,6-dioxo-2,9,10-triazapentacyclo[8.7.0.01,13.04,9.011,13]heptadeca-4,7-diene-7-carboximidothioate |
| SMILES | [H]/N=C(\S/C(Cc1ccc(F)cc1)=N/[H])c1cn2c(c(O)c1=O)C(=O)N(CC)C13CCC(C=O)(COCC)CC14CC4N23 |
| InChI | InChI=1S/C29H32FN5O5S/c1-3-33-26(39)22-24(38)23(37)19(25(32)41-21(31)11-17-5-7-18(30)8-6-17)13-34(22)35-20-12-28(20)14-27(15-36,16-40-4-2)9-10-29(28,33)35/h5-8,13,15,20,31-32,38H,3-4,9-12,14,16H2,1-2H3/b31-21+,32-25- |
| InChIKey | FKEHYWLKVGTJIL-IHFRXTRBSA-N |
| XLogP | 3.26 |
| TPSA | 139.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|