C23H24F2N6O4S — CID 144863931
[2-(2,4-difluorophenyl)ethanimidoyl] 5'-hydroxy-1',3'-dimethyl-2,4',6'-trioxospiro[azepane-5,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboximidothioate (PubChem CID 144863931) has the molecular formula C23H24F2N6O4S and a molecular weight of 518.55 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)ethanimidoyl] 5'-hydroxy-1',3'-dimethyl-2,4',6'-trioxospiro[azepane-5,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboximidothioate.
| Compound Name | [2-(2,4-difluorophenyl)ethanimidoyl] 5'-hydroxy-1',3'-dimethyl-2,4',6'-trioxospiro[azepane-5,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboximidothioate |
|---|---|
| PubChem CID | 144863931 |
| Molecular Formula | C23H24F2N6O4S |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | [2-(2,4-difluorophenyl)ethanimidoyl] 5'-hydroxy-1',3'-dimethyl-2,4',6'-trioxospiro[azepane-5,2'-pyrido[2,1-f][1,2,4]triazine]-7'-carboximidothioate |
| SMILES | [H]/N=C(\S/C(Cc1ccc(F)cc1F)=N/[H])c1cn2c(c(O)c1=O)C(=O)N(C)C1(CCNC(=O)CC1)N2C |
| InChI | InChI=1S/C23H24F2N6O4S/c1-29-22(35)18-20(34)19(33)14(11-31(18)30(2)23(29)6-5-17(32)28-8-7-23)21(27)36-16(26)9-12-3-4-13(24)10-15(12)25/h3-4,10-11,26-27,34H,5-9H2,1-2H3,(H,28,32)/b26-16+,27-21- |
| InChIKey | DRUKTHQVYVOZOV-SGIQSXFYSA-N |
| XLogP | 1.76 |
| TPSA | 142.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|