C19H20F2N2O5S — CID 144870914
[2-(2,4-difluorophenyl)ethanimidoyl] 6-formyl-5-methoxy-4-oxopyran-3-carboximidothioate;methoxyethane (PubChem CID 144870914) has the molecular formula C19H20F2N2O5S and a molecular weight of 426.44 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)ethanimidoyl] 6-formyl-5-methoxy-4-oxopyran-3-carboximidothioate;methoxyethane.
| Compound Name | [2-(2,4-difluorophenyl)ethanimidoyl] 6-formyl-5-methoxy-4-oxopyran-3-carboximidothioate;methoxyethane |
|---|---|
| PubChem CID | 144870914 |
| Molecular Formula | C19H20F2N2O5S |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | [2-(2,4-difluorophenyl)ethanimidoyl] 6-formyl-5-methoxy-4-oxopyran-3-carboximidothioate;methoxyethane |
| SMILES | CCOC.[H]/N=C(\S/C(Cc1ccc(F)cc1F)=N/[H])c1coc(C=O)c(OC)c1=O |
| InChI | InChI=1S/C16H12F2N2O4S.C3H8O/c1-23-15-12(6-21)24-7-10(14(15)22)16(20)25-13(19)4-8-2-3-9(17)5-11(8)18;1-3-4-2/h2-3,5-7,19-20H,4H2,1H3;3H2,1-2H3/b19-13+,20-16-; |
| InChIKey | ZJIZZLNDTYXULI-DILMFHHYSA-N |
| XLogP | 3.67 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|