C28H34F2N6O3S — CID 123556807
[2-(2,4-difluorophenyl)ethanimidoyl] 1,3-dimethyl-4'-[(1-methylcyclopropyl)carbamoyl]-4,5-dioxospiro[4a,6-dihydropyrido[2,1-f][1,2,4]triazine-2,1'-cyclohexane]-7-carboximidothioate (PubChem CID 123556807) has the molecular formula C28H34F2N6O3S and a molecular weight of 572.68 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)ethanimidoyl] 1,3-dimethyl-4'-[(1-methylcyclopropyl)carbamoyl]-4,5-dioxospiro[4a,6-dihydropyrido[2,1-f][1,2,4]triazine-2,1'-cyclohexane]-7-carboximidothioate.
| Compound Name | [2-(2,4-difluorophenyl)ethanimidoyl] 1,3-dimethyl-4'-[(1-methylcyclopropyl)carbamoyl]-4,5-dioxospiro[4a,6-dihydropyrido[2,1-f][1,2,4]triazine-2,1'-cyclohexane]-7-carboximidothioate |
|---|---|
| PubChem CID | 123556807 |
| Molecular Formula | C28H34F2N6O3S |
| Molecular Weight | 572.68 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | [2-(2,4-difluorophenyl)ethanimidoyl] 1,3-dimethyl-4'-[(1-methylcyclopropyl)carbamoyl]-4,5-dioxospiro[4a,6-dihydropyrido[2,1-f][1,2,4]triazine-2,1'-cyclohexane]-7-carboximidothioate |
| SMILES | [H]/N=C(\S/C(Cc1ccc(F)cc1F)=N/[H])C1=CN2C(C(=O)C1)C(=O)N(C)C1(CCC(C(=O)NC3(C)CC3)CC1)N2C |
| InChI | InChI=1S/C28H34F2N6O3S/c1-27(10-11-27)33-25(38)16-6-8-28(9-7-16)34(2)26(39)23-21(37)12-18(15-36(23)35(28)3)24(32)40-22(31)13-17-4-5-19(29)14-20(17)30/h4-5,14-16,23,31-32H,6-13H2,1-3H3,(H,33,38)/b31-22+,32-24- |
| InChIKey | FKJWMWAFQBAHFS-URNURFNSSA-N |
| XLogP | 3.60 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.68 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|