C29H33F2N4O8P — CID 146554777
3-[7-[(2,4-difluorophenyl)methylcarbamoyl]-6-hydroxy-3-methyl-4-oxo-5-phenylmethoxyspiro[6H-pyrido[2,1-f][1,2,4]triazine-2,3'-oxolane]-1-yl]propylphosphonic acid (PubChem CID 146554777) has the molecular formula C29H33F2N4O8P and a molecular weight of 634.57 g/mol. Its IUPAC name is 3-[7-[(2,4-difluorophenyl)methylcarbamoyl]-6-hydroxy-3-methyl-4-oxo-5-phenylmethoxyspiro[6H-pyrido[2,1-f][1,2,4]triazine-2,3'-oxolane]-1-yl]propylphosphonic acid.
| Compound Name | 3-[7-[(2,4-difluorophenyl)methylcarbamoyl]-6-hydroxy-3-methyl-4-oxo-5-phenylmethoxyspiro[6H-pyrido[2,1-f][1,2,4]triazine-2,3'-oxolane]-1-yl]propylphosphonic acid |
|---|---|
| PubChem CID | 146554777 |
| Molecular Formula | C29H33F2N4O8P |
| Molecular Weight | 634.57 g/mol |
| Exact Mass | 634.20 |
| IUPAC Name | 3-[7-[(2,4-difluorophenyl)methylcarbamoyl]-6-hydroxy-3-methyl-4-oxo-5-phenylmethoxyspiro[6H-pyrido[2,1-f][1,2,4]triazine-2,3'-oxolane]-1-yl]propylphosphonic acid |
| SMILES | CN1C(=O)C2=C(OCc3ccccc3)C(O)C(C(=O)NCc3ccc(F)cc3F)=CN2N(CCCP(=O)(O)O)C12CCOC2 |
| InChI | InChI=1S/C29H33F2N4O8P/c1-33-28(38)24-26(43-17-19-6-3-2-4-7-19)25(36)22(27(37)32-15-20-8-9-21(30)14-23(20)31)16-34(24)35(11-5-13-44(39,40)41)29(33)10-12-42-18-29/h2-4,6-9,14,16,25,36H,5,10-13,15,17-18H2,1H3,(H,32,37)(H2,39,40,41) |
| InChIKey | RJSLLWRWOAEIJY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.57 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|