C29H33F2N4O8P — CID 167067890
2-[7-[(2,4-difluorophenyl)methylcarbamoyl]-2-(ethoxymethyl)-3-methyl-4,6-dioxo-5-phenylmethoxy-2,9-dihydro-[1,2,4]triazino[1,6-a]azepin-1-yl]ethylphosphonic acid (PubChem CID 167067890) has the molecular formula C29H33F2N4O8P and a molecular weight of 634.57 g/mol. Its IUPAC name is 2-[7-[(2,4-difluorophenyl)methylcarbamoyl]-2-(ethoxymethyl)-3-methyl-4,6-dioxo-5-phenylmethoxy-2,9-dihydro-[1,2,4]triazino[1,6-a]azepin-1-yl]ethylphosphonic acid.
| Compound Name | 2-[7-[(2,4-difluorophenyl)methylcarbamoyl]-2-(ethoxymethyl)-3-methyl-4,6-dioxo-5-phenylmethoxy-2,9-dihydro-[1,2,4]triazino[1,6-a]azepin-1-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 167067890 |
| Molecular Formula | C29H33F2N4O8P |
| Molecular Weight | 634.57 g/mol |
| Exact Mass | 634.20 |
| IUPAC Name | 2-[7-[(2,4-difluorophenyl)methylcarbamoyl]-2-(ethoxymethyl)-3-methyl-4,6-dioxo-5-phenylmethoxy-2,9-dihydro-[1,2,4]triazino[1,6-a]azepin-1-yl]ethylphosphonic acid |
| SMILES | CCOCC1N(C)C(=O)C2=C(OCc3ccccc3)C(=O)C(C(=O)NCc3ccc(F)cc3F)=CCN2N1CCP(=O)(O)O |
| InChI | InChI=1S/C29H33F2N4O8P/c1-3-42-18-24-33(2)29(38)25-27(43-17-19-7-5-4-6-8-19)26(36)22(11-12-35(25)34(24)13-14-44(39,40)41)28(37)32-16-20-9-10-21(30)15-23(20)31/h4-11,15,24H,3,12-14,16-18H2,1-2H3,(H,32,37)(H2,39,40,41) |
| InChIKey | KNWYKMIILNSTFW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 148.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.57 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|