C27H25F2N3O4 — CID 163235277
(4Z)-N-[(2,4-difluorophenyl)methyl]-2,3-dimethyl-1,10-dioxo-11-phenylmethoxy-3,6-dihydropyrido[1,2-a][1,4]diazocine-9-carboxamide (PubChem CID 163235277) has the molecular formula C27H25F2N3O4 and a molecular weight of 493.51 g/mol. Its IUPAC name is (4Z)-N-[(2,4-difluorophenyl)methyl]-2,3-dimethyl-1,10-dioxo-11-phenylmethoxy-3,6-dihydropyrido[1,2-a][1,4]diazocine-9-carboxamide.
| Compound Name | (4Z)-N-[(2,4-difluorophenyl)methyl]-2,3-dimethyl-1,10-dioxo-11-phenylmethoxy-3,6-dihydropyrido[1,2-a][1,4]diazocine-9-carboxamide |
|---|---|
| PubChem CID | 163235277 |
| Molecular Formula | C27H25F2N3O4 |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | (4Z)-N-[(2,4-difluorophenyl)methyl]-2,3-dimethyl-1,10-dioxo-11-phenylmethoxy-3,6-dihydropyrido[1,2-a][1,4]diazocine-9-carboxamide |
| SMILES | CC1/C=C\Cn2cc(C(=O)NCc3ccc(F)cc3F)c(=O)c(OCc3ccccc3)c2C(=O)N1C |
| InChI | InChI=1S/C27H25F2N3O4/c1-17-7-6-12-32-15-21(26(34)30-14-19-10-11-20(28)13-22(19)29)24(33)25(23(32)27(35)31(17)2)36-16-18-8-4-3-5-9-18/h3-11,13,15,17H,12,14,16H2,1-2H3,(H,30,34)/b7-6- |
| InChIKey | HWTOEOULHVXZOK-SREVYHEPSA-N |
| XLogP | 3.67 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|