C30H32F2N4O4S — CID 130426326
(5S)-N-[(2,4-difluorophenyl)methyl]-5-methyl-4-(2-methylpropyl)-8,11-dioxo-10-phenylmethoxy-3-sulfanyl-1,4,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide (PubChem CID 130426326) has the molecular formula C30H32F2N4O4S and a molecular weight of 582.67 g/mol. Its IUPAC name is (5S)-N-[(2,4-difluorophenyl)methyl]-5-methyl-4-(2-methylpropyl)-8,11-dioxo-10-phenylmethoxy-3-sulfanyl-1,4,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide.
| Compound Name | (5S)-N-[(2,4-difluorophenyl)methyl]-5-methyl-4-(2-methylpropyl)-8,11-dioxo-10-phenylmethoxy-3-sulfanyl-1,4,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
|---|---|
| PubChem CID | 130426326 |
| Molecular Formula | C30H32F2N4O4S |
| Molecular Weight | 582.67 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | (5S)-N-[(2,4-difluorophenyl)methyl]-5-methyl-4-(2-methylpropyl)-8,11-dioxo-10-phenylmethoxy-3-sulfanyl-1,4,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
| SMILES | CC(C)CN1[C@@H](C)CN2C(=O)c3c(OCc4ccccc4)c(=O)c(C(=O)NCc4ccc(F)cc4F)cn3CC21S |
| InChI | InChI=1S/C30H32F2N4O4S/c1-18(2)13-35-19(3)14-36-29(39)25-27(40-16-20-7-5-4-6-8-20)26(37)23(15-34(25)17-30(35,36)41)28(38)33-12-21-9-10-22(31)11-24(21)32/h4-11,15,18-19,41H,12-14,16-17H2,1-3H3,(H,33,38)/t19-,30?/m0/s1 |
| InChIKey | PDSVPKRUVAEJOO-QUZMYUOTSA-N |
| XLogP | 4.03 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.67 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|