C31H31F2N3O6S — CID 169314397
methyl 2-[(1R,10S,13R)-4-[(2,4-difluorophenyl)methylcarbamoyl]-10-methyl-5,8-dioxo-6-phenylmethoxy-13-sulfanyl-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-dien-13-yl]acetate (PubChem CID 169314397) has the molecular formula C31H31F2N3O6S and a molecular weight of 611.67 g/mol. Its IUPAC name is methyl 2-[(1R,10S,13R)-4-[(2,4-difluorophenyl)methylcarbamoyl]-10-methyl-5,8-dioxo-6-phenylmethoxy-13-sulfanyl-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-dien-13-yl]acetate.
| Compound Name | methyl 2-[(1R,10S,13R)-4-[(2,4-difluorophenyl)methylcarbamoyl]-10-methyl-5,8-dioxo-6-phenylmethoxy-13-sulfanyl-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-dien-13-yl]acetate |
|---|---|
| PubChem CID | 169314397 |
| Molecular Formula | C31H31F2N3O6S |
| Molecular Weight | 611.67 g/mol |
| Exact Mass | 611.19 |
| IUPAC Name | methyl 2-[(1R,10S,13R)-4-[(2,4-difluorophenyl)methylcarbamoyl]-10-methyl-5,8-dioxo-6-phenylmethoxy-13-sulfanyl-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-dien-13-yl]acetate |
| SMILES | COC(=O)C[C@]1(S)CC[C@H](C)N2C[C@H]1n1cc(C(=O)NCc3ccc(F)cc3F)c(=O)c(OCc3ccccc3)c1C2=O |
| InChI | InChI=1S/C31H31F2N3O6S/c1-18-10-11-31(43,13-25(37)41-2)24-16-35(18)30(40)26-28(42-17-19-6-4-3-5-7-19)27(38)22(15-36(24)26)29(39)34-14-20-8-9-21(32)12-23(20)33/h3-9,12,15,18,24,43H,10-11,13-14,16-17H2,1-2H3,(H,34,39)/t18-,24+,31+/m0/s1 |
| InChIKey | VTPBHQVELBHRQL-IKEHMOJVSA-N |
| XLogP | 4.05 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.67 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|