C30H29BrF3N3O5 — CID 169314729
(1R,10S,13R)-13-(2-bromoethyl)-13-hydroxy-10-methyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide (PubChem CID 169314729) has the molecular formula C30H29BrF3N3O5 and a molecular weight of 648.48 g/mol. Its IUPAC name is (1R,10S,13R)-13-(2-bromoethyl)-13-hydroxy-10-methyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide.
| Compound Name | (1R,10S,13R)-13-(2-bromoethyl)-13-hydroxy-10-methyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 169314729 |
| Molecular Formula | C30H29BrF3N3O5 |
| Molecular Weight | 648.48 g/mol |
| Exact Mass | 647.12 |
| IUPAC Name | (1R,10S,13R)-13-(2-bromoethyl)-13-hydroxy-10-methyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
| SMILES | C[C@H]1CC[C@@](O)(CCBr)[C@H]2CN1C(=O)c1c(OCc3ccccc3)c(=O)c(C(=O)NCc3c(F)cc(F)cc3F)cn12 |
| InChI | InChI=1S/C30H29BrF3N3O5/c1-17-7-8-30(41,9-10-31)24-15-36(17)29(40)25-27(42-16-18-5-3-2-4-6-18)26(38)21(14-37(24)25)28(39)35-13-20-22(33)11-19(32)12-23(20)34/h2-6,11-12,14,17,24,41H,7-10,13,15-16H2,1H3,(H,35,39)/t17-,24+,30+/m0/s1 |
| InChIKey | UBBXKMSRHXMYBM-ZYABWWMVSA-N |
| XLogP | 4.47 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|