C26H30F3N3O6 — CID 169314913
(1R,10S,13R)-6-butoxy-13-hydroxy-13-(hydroxymethyl)-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide (PubChem CID 169314913) has the molecular formula C26H30F3N3O6 and a molecular weight of 537.54 g/mol. Its IUPAC name is (1R,10S,13R)-6-butoxy-13-hydroxy-13-(hydroxymethyl)-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide.
| Compound Name | (1R,10S,13R)-6-butoxy-13-hydroxy-13-(hydroxymethyl)-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 169314913 |
| Molecular Formula | C26H30F3N3O6 |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | (1R,10S,13R)-6-butoxy-13-hydroxy-13-(hydroxymethyl)-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
| SMILES | CCCCOc1c2n(cc(C(=O)NCc3c(F)cc(F)cc3F)c1=O)[C@@H]1CN(C2=O)[C@@H](C)CC[C@]1(O)CO |
| InChI | InChI=1S/C26H30F3N3O6/c1-3-4-7-38-23-21-25(36)31-12-20(26(37,13-33)6-5-14(31)2)32(21)11-17(22(23)34)24(35)30-10-16-18(28)8-15(27)9-19(16)29/h8-9,11,14,20,33,37H,3-7,10,12-13H2,1-2H3,(H,30,35)/t14-,20+,26-/m0/s1 |
| InChIKey | IEDHEBQWFXZEQY-YMAGALGMSA-N |
| XLogP | 2.28 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|