C27H29F3N4O6 — CID 169314890
(1'R,5R,10'S)-6'-butoxy-10'-methyl-3,5',8'-trioxo-N-[(2,4,6-trifluorophenyl)methyl]spiro[1,2-oxazolidine-5,13'-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene]-4'-carboxamide (PubChem CID 169314890) has the molecular formula C27H29F3N4O6 and a molecular weight of 562.55 g/mol. Its IUPAC name is (1'R,5R,10'S)-6'-butoxy-10'-methyl-3,5',8'-trioxo-N-[(2,4,6-trifluorophenyl)methyl]spiro[1,2-oxazolidine-5,13'-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene]-4'-carboxamide.
| Compound Name | (1'R,5R,10'S)-6'-butoxy-10'-methyl-3,5',8'-trioxo-N-[(2,4,6-trifluorophenyl)methyl]spiro[1,2-oxazolidine-5,13'-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene]-4'-carboxamide |
|---|---|
| PubChem CID | 169314890 |
| Molecular Formula | C27H29F3N4O6 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | (1'R,5R,10'S)-6'-butoxy-10'-methyl-3,5',8'-trioxo-N-[(2,4,6-trifluorophenyl)methyl]spiro[1,2-oxazolidine-5,13'-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene]-4'-carboxamide |
| SMILES | CCCCOc1c2n(cc(C(=O)NCc3c(F)cc(F)cc3F)c1=O)[C@@H]1CN(C2=O)[C@@H](C)CC[C@@]12CC(=O)NO2 |
| InChI | InChI=1S/C27H29F3N4O6/c1-3-4-7-39-24-22-26(38)33-13-20(27(6-5-14(33)2)10-21(35)32-40-27)34(22)12-17(23(24)36)25(37)31-11-16-18(29)8-15(28)9-19(16)30/h8-9,12,14,20H,3-7,10-11,13H2,1-2H3,(H,31,37)(H,32,35)/t14-,20+,27+/m0/s1 |
| InChIKey | WUDKGPUBFHBHOM-GLJIIUCCSA-N |
| XLogP | 2.74 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|