C28H31ClF2N4O5 — CID 169314930
(1R,10S,13S)-6-butoxy-N-[(3-chloro-2,4-difluorophenyl)methyl]-3',10-dimethyl-5,8-dioxospiro[2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-13,5'-4H-1,2-oxazole]-4-carboxamide (PubChem CID 169314930) has the molecular formula C28H31ClF2N4O5 and a molecular weight of 577.03 g/mol. Its IUPAC name is (1R,10S,13S)-6-butoxy-N-[(3-chloro-2,4-difluorophenyl)methyl]-3',10-dimethyl-5,8-dioxospiro[2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-13,5'-4H-1,2-oxazole]-4-carboxamide.
| Compound Name | (1R,10S,13S)-6-butoxy-N-[(3-chloro-2,4-difluorophenyl)methyl]-3',10-dimethyl-5,8-dioxospiro[2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-13,5'-4H-1,2-oxazole]-4-carboxamide |
|---|---|
| PubChem CID | 169314930 |
| Molecular Formula | C28H31ClF2N4O5 |
| Molecular Weight | 577.03 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | (1R,10S,13S)-6-butoxy-N-[(3-chloro-2,4-difluorophenyl)methyl]-3',10-dimethyl-5,8-dioxospiro[2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-13,5'-4H-1,2-oxazole]-4-carboxamide |
| SMILES | CCCCOc1c2n(cc(C(=O)NCc3ccc(F)c(Cl)c3F)c1=O)[C@@H]1CN(C2=O)[C@@H](C)CC[C@]12CC(C)=NO2 |
| InChI | InChI=1S/C28H31ClF2N4O5/c1-4-5-10-39-25-23-27(38)34-14-20(28(9-8-16(34)3)11-15(2)33-40-28)35(23)13-18(24(25)36)26(37)32-12-17-6-7-19(30)21(29)22(17)31/h6-7,13,16,20H,4-5,8-12,14H2,1-3H3,(H,32,37)/t16-,20+,28-/m0/s1 |
| InChIKey | FDVACQIUOFTARV-PYFSPHLCSA-N |
| XLogP | 4.60 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.03 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|