C25H26F2N4O6 — CID 176979964
(1R,10S,13S)-N-[(2,4-difluorophenyl)methyl]-6-(hydroxymethoxy)-3',10-dimethyl-5,8-dioxospiro[2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-13,5'-4H-1,2-oxazole]-4-carboxamide (PubChem CID 176979964) has the molecular formula C25H26F2N4O6 and a molecular weight of 516.50 g/mol. Its IUPAC name is (1R,10S,13S)-N-[(2,4-difluorophenyl)methyl]-6-(hydroxymethoxy)-3',10-dimethyl-5,8-dioxospiro[2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-13,5'-4H-1,2-oxazole]-4-carboxamide.
| Compound Name | (1R,10S,13S)-N-[(2,4-difluorophenyl)methyl]-6-(hydroxymethoxy)-3',10-dimethyl-5,8-dioxospiro[2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-13,5'-4H-1,2-oxazole]-4-carboxamide |
|---|---|
| PubChem CID | 176979964 |
| Molecular Formula | C25H26F2N4O6 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | (1R,10S,13S)-N-[(2,4-difluorophenyl)methyl]-6-(hydroxymethoxy)-3',10-dimethyl-5,8-dioxospiro[2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-13,5'-4H-1,2-oxazole]-4-carboxamide |
| SMILES | CC1=NO[C@@]2(CC[C@H](C)N3C[C@H]2n2cc(C(=O)NCc4ccc(F)cc4F)c(=O)c(OCO)c2C3=O)C1 |
| InChI | InChI=1S/C25H26F2N4O6/c1-13-8-25(37-29-13)6-5-14(2)30-11-19(25)31-10-17(21(33)22(36-12-32)20(31)24(30)35)23(34)28-9-15-3-4-16(26)7-18(15)27/h3-4,7,10,14,19,32H,5-6,8-9,11-12H2,1-2H3,(H,28,34)/t14-,19+,25-/m0/s1 |
| InChIKey | SPXVSEKFXARKGT-FSKGLPCWSA-N |
| XLogP | 2.10 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|