C26H28F3N3O5 — CID 164757471
(1R,10S,13R)-6-butoxy-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]spiro[2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-13,2'-oxirane]-4-carboxamide (PubChem CID 164757471) has the molecular formula C26H28F3N3O5 and a molecular weight of 519.52 g/mol. Its IUPAC name is (1R,10S,13R)-6-butoxy-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]spiro[2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-13,2'-oxirane]-4-carboxamide.
| Compound Name | (1R,10S,13R)-6-butoxy-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]spiro[2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-13,2'-oxirane]-4-carboxamide |
|---|---|
| PubChem CID | 164757471 |
| Molecular Formula | C26H28F3N3O5 |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | (1R,10S,13R)-6-butoxy-10-methyl-5,8-dioxo-N-[(2,4,6-trifluorophenyl)methyl]spiro[2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-13,2'-oxirane]-4-carboxamide |
| SMILES | CCCCOc1c2n(cc(C(=O)NCc3c(F)cc(F)cc3F)c1=O)[C@@H]1CN(C2=O)[C@@H](C)CC[C@]12CO2 |
| InChI | InChI=1S/C26H28F3N3O5/c1-3-4-7-36-23-21-25(35)31-12-20(26(13-37-26)6-5-14(31)2)32(21)11-17(22(23)33)24(34)30-10-16-18(28)8-15(27)9-19(16)29/h8-9,11,14,20H,3-7,10,12-13H2,1-2H3,(H,30,34)/t14-,20+,26-/m0/s1 |
| InChIKey | XXAWFOLEVWNZMD-YMAGALGMSA-N |
| XLogP | 3.32 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|