C28H30F2N4O6 — CID 169314555
(1'R,5R,10'S)-6'-butoxy-N-[(2,4-difluorophenyl)methyl]-3,10'-dimethyl-4,5',8'-trioxospiro[1,2-oxazole-5,13'-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene]-4'-carboxamide (PubChem CID 169314555) has the molecular formula C28H30F2N4O6 and a molecular weight of 556.57 g/mol. Its IUPAC name is (1'R,5R,10'S)-6'-butoxy-N-[(2,4-difluorophenyl)methyl]-3,10'-dimethyl-4,5',8'-trioxospiro[1,2-oxazole-5,13'-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene]-4'-carboxamide.
| Compound Name | (1'R,5R,10'S)-6'-butoxy-N-[(2,4-difluorophenyl)methyl]-3,10'-dimethyl-4,5',8'-trioxospiro[1,2-oxazole-5,13'-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene]-4'-carboxamide |
|---|---|
| PubChem CID | 169314555 |
| Molecular Formula | C28H30F2N4O6 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | (1'R,5R,10'S)-6'-butoxy-N-[(2,4-difluorophenyl)methyl]-3,10'-dimethyl-4,5',8'-trioxospiro[1,2-oxazole-5,13'-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene]-4'-carboxamide |
| SMILES | CCCCOc1c2n(cc(C(=O)NCc3ccc(F)cc3F)c1=O)[C@@H]1CN(C2=O)[C@@H](C)CC[C@@]12ON=C(C)C2=O |
| InChI | InChI=1S/C28H30F2N4O6/c1-4-5-10-39-24-22-27(38)33-14-21(28(9-8-15(33)2)25(36)16(3)32-40-28)34(22)13-19(23(24)35)26(37)31-12-17-6-7-18(29)11-20(17)30/h6-7,11,13,15,21H,4-5,8-10,12,14H2,1-3H3,(H,31,37)/t15-,21+,28+/m0/s1 |
| InChIKey | WBYRHYPMVFZFNB-QKMYBKPUSA-N |
| XLogP | 3.13 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|