C27H29F3N4O6 — CID 169314472
(1'R,5R,10'S)-6'-butoxy-3,10'-dimethyl-5',8'-dioxo-N-[(2,4,6-trifluorophenyl)methyl]spiro[1,4,2-dioxazole-5,13'-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene]-4'-carboxamide (PubChem CID 169314472) has the molecular formula C27H29F3N4O6 and a molecular weight of 562.55 g/mol. Its IUPAC name is (1'R,5R,10'S)-6'-butoxy-3,10'-dimethyl-5',8'-dioxo-N-[(2,4,6-trifluorophenyl)methyl]spiro[1,4,2-dioxazole-5,13'-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene]-4'-carboxamide.
| Compound Name | (1'R,5R,10'S)-6'-butoxy-3,10'-dimethyl-5',8'-dioxo-N-[(2,4,6-trifluorophenyl)methyl]spiro[1,4,2-dioxazole-5,13'-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene]-4'-carboxamide |
|---|---|
| PubChem CID | 169314472 |
| Molecular Formula | C27H29F3N4O6 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | (1'R,5R,10'S)-6'-butoxy-3,10'-dimethyl-5',8'-dioxo-N-[(2,4,6-trifluorophenyl)methyl]spiro[1,4,2-dioxazole-5,13'-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene]-4'-carboxamide |
| SMILES | CCCCOc1c2n(cc(C(=O)NCc3c(F)cc(F)cc3F)c1=O)[C@@H]1CN(C2=O)[C@@H](C)CC[C@@]12ON=C(C)O2 |
| InChI | InChI=1S/C27H29F3N4O6/c1-4-5-8-38-24-22-26(37)33-13-21(27(7-6-14(33)2)39-15(3)32-40-27)34(22)12-18(23(24)35)25(36)31-11-17-19(29)9-16(28)10-20(17)30/h9-10,12,14,21H,4-8,11,13H2,1-3H3,(H,31,36)/t14-,21+,27+/m0/s1 |
| InChIKey | BUEFKWKIUSYMKD-LXCWDIJASA-N |
| XLogP | 3.63 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|