C36H32F3N3O5S — CID 169314586
(1R,10S,13R)-10-methyl-5,8-dioxo-13-phenacylsulfanyl-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide (PubChem CID 169314586) has the molecular formula C36H32F3N3O5S and a molecular weight of 675.73 g/mol. Its IUPAC name is (1R,10S,13R)-10-methyl-5,8-dioxo-13-phenacylsulfanyl-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide.
| Compound Name | (1R,10S,13R)-10-methyl-5,8-dioxo-13-phenacylsulfanyl-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 169314586 |
| Molecular Formula | C36H32F3N3O5S |
| Molecular Weight | 675.73 g/mol |
| Exact Mass | 675.20 |
| IUPAC Name | (1R,10S,13R)-10-methyl-5,8-dioxo-13-phenacylsulfanyl-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
| SMILES | C[C@H]1CC[C@@H](SCC(=O)c2ccccc2)[C@H]2CN1C(=O)c1c(OCc3ccccc3)c(=O)c(C(=O)NCc3c(F)cc(F)cc3F)cn12 |
| InChI | InChI=1S/C36H32F3N3O5S/c1-21-12-13-31(48-20-30(43)23-10-6-3-7-11-23)29-18-41(21)36(46)32-34(47-19-22-8-4-2-5-9-22)33(44)26(17-42(29)32)35(45)40-16-25-27(38)14-24(37)15-28(25)39/h2-11,14-15,17,21,29,31H,12-13,16,18-20H2,1H3,(H,40,45)/t21-,29+,31+/m0/s1 |
| InChIKey | PWWIYNWILVMDRZ-HQAIZHAKSA-N |
| XLogP | 5.94 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.73 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |