C35H28F3N3O6 — CID 163235107
[(1R,10S,13R)-10-methyl-5,8-dioxo-6-phenylmethoxy-4-[(2,4,6-trifluorophenyl)methylcarbamoyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-trien-13-yl] benzoate (PubChem CID 163235107) has the molecular formula C35H28F3N3O6 and a molecular weight of 643.62 g/mol. Its IUPAC name is [(1R,10S,13R)-10-methyl-5,8-dioxo-6-phenylmethoxy-4-[(2,4,6-trifluorophenyl)methylcarbamoyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-trien-13-yl] benzoate.
| Compound Name | [(1R,10S,13R)-10-methyl-5,8-dioxo-6-phenylmethoxy-4-[(2,4,6-trifluorophenyl)methylcarbamoyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-trien-13-yl] benzoate |
|---|---|
| PubChem CID | 163235107 |
| Molecular Formula | C35H28F3N3O6 |
| Molecular Weight | 643.62 g/mol |
| Exact Mass | 643.19 |
| IUPAC Name | [(1R,10S,13R)-10-methyl-5,8-dioxo-6-phenylmethoxy-4-[(2,4,6-trifluorophenyl)methylcarbamoyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-trien-13-yl] benzoate |
| SMILES | C[C@H]1C=C[C@@H](OC(=O)c2ccccc2)[C@H]2CN1C(=O)c1c(OCc3ccccc3)c(=O)c(C(=O)NCc3c(F)cc(F)cc3F)cn12 |
| InChI | InChI=1S/C35H28F3N3O6/c1-20-12-13-29(47-35(45)22-10-6-3-7-11-22)28-18-40(20)34(44)30-32(46-19-21-8-4-2-5-9-21)31(42)25(17-41(28)30)33(43)39-16-24-26(37)14-23(36)15-27(24)38/h2-15,17,20,28-29H,16,18-19H2,1H3,(H,39,43)/t20-,28+,29+/m0/s1 |
| InChIKey | CPTUSRVFENRKCC-XYQOHPTNSA-N |
| XLogP | 4.96 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.62 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|