C29H26F3N3O5 — CID 163235162
(1R,10S,13S)-13-hydroxy-10,13-dimethyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide (PubChem CID 163235162) has the molecular formula C29H26F3N3O5 and a molecular weight of 553.54 g/mol. Its IUPAC name is (1R,10S,13S)-13-hydroxy-10,13-dimethyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide.
| Compound Name | (1R,10S,13S)-13-hydroxy-10,13-dimethyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
|---|---|
| PubChem CID | 163235162 |
| Molecular Formula | C29H26F3N3O5 |
| Molecular Weight | 553.54 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | (1R,10S,13S)-13-hydroxy-10,13-dimethyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
| SMILES | C[C@H]1C=C[C@](C)(O)[C@H]2CN1C(=O)c1c(OCc3ccccc3)c(=O)c(C(=O)NCc3c(F)cc(F)cc3F)cn12 |
| InChI | InChI=1S/C29H26F3N3O5/c1-16-8-9-29(2,39)23-14-34(16)28(38)24-26(40-15-17-6-4-3-5-7-17)25(36)20(13-35(23)24)27(37)33-12-19-21(31)10-18(30)11-22(19)32/h3-11,13,16,23,39H,12,14-15H2,1-2H3,(H,33,37)/t16-,23+,29-/m0/s1 |
| InChIKey | SWJGEYBYJJUXBA-JVXONFNOSA-N |
| XLogP | 3.48 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|