C28H24F5N3O4 — CID 155145548
(1S,10S)-12,12-difluoro-10-methyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide (PubChem CID 155145548) has the molecular formula C28H24F5N3O4 and a molecular weight of 561.51 g/mol. Its IUPAC name is (1S,10S)-12,12-difluoro-10-methyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide.
| Compound Name | (1S,10S)-12,12-difluoro-10-methyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 155145548 |
| Molecular Formula | C28H24F5N3O4 |
| Molecular Weight | 561.51 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | (1S,10S)-12,12-difluoro-10-methyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
| SMILES | C[C@H]1CC(F)(F)C[C@H]2CN1C(=O)c1c(OCc3ccccc3)c(=O)c(C(=O)NCc3c(F)cc(F)cc3F)cn12 |
| InChI | InChI=1S/C28H24F5N3O4/c1-15-9-28(32,33)10-18-12-35(15)27(39)23-25(40-14-16-5-3-2-4-6-16)24(37)20(13-36(18)23)26(38)34-11-19-21(30)7-17(29)8-22(19)31/h2-8,13,15,18H,9-12,14H2,1H3,(H,34,38)/t15-,18-/m0/s1 |
| InChIKey | IWAXPMRHTCIMJO-YJBOKZPZSA-N |
| XLogP | 4.59 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |