C28H26F3N3O5 — CID 155146000
(1S,12R)-12-hydroxy-12-methyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide (PubChem CID 155146000) has the molecular formula C28H26F3N3O5 and a molecular weight of 541.53 g/mol. Its IUPAC name is (1S,12R)-12-hydroxy-12-methyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide.
| Compound Name | (1S,12R)-12-hydroxy-12-methyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 155146000 |
| Molecular Formula | C28H26F3N3O5 |
| Molecular Weight | 541.53 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | (1S,12R)-12-hydroxy-12-methyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
| SMILES | C[C@@]1(O)CCN2C[C@H](C1)n1cc(C(=O)NCc3c(F)cc(F)cc3F)c(=O)c(OCc3ccccc3)c1C2=O |
| InChI | InChI=1S/C28H26F3N3O5/c1-28(38)7-8-33-13-18(11-28)34-14-20(26(36)32-12-19-21(30)9-17(29)10-22(19)31)24(35)25(23(34)27(33)37)39-15-16-5-3-2-4-6-16/h2-6,9-10,14,18,38H,7-8,11-13,15H2,1H3,(H,32,36)/t18-,28+/m0/s1 |
| InChIKey | JQRXRFNVTJULOK-XDBZFTIUSA-N |
| XLogP | 3.32 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |