C28H25F4N3O4 — CID 155190240
(1R,13S)-13-(fluoromethyl)-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide (PubChem CID 155190240) has the molecular formula C28H25F4N3O4 and a molecular weight of 543.52 g/mol. Its IUPAC name is (1R,13S)-13-(fluoromethyl)-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide.
| Compound Name | (1R,13S)-13-(fluoromethyl)-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 155190240 |
| Molecular Formula | C28H25F4N3O4 |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | (1R,13S)-13-(fluoromethyl)-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
| SMILES | O=C(NCc1c(F)cc(F)cc1F)c1cn2c(c(OCc3ccccc3)c1=O)C(=O)N1CCC[C@H](CF)[C@@H]2C1 |
| InChI | InChI=1S/C28H25F4N3O4/c29-11-17-7-4-8-34-14-23(17)35-13-20(27(37)33-12-19-21(31)9-18(30)10-22(19)32)25(36)26(24(35)28(34)38)39-15-16-5-2-1-3-6-16/h1-3,5-6,9-10,13,17,23H,4,7-8,11-12,14-15H2,(H,33,37)/t17-,23+/m1/s1 |
| InChIKey | VDKGQSGGDFOPFR-HXOBKFHXSA-N |
| XLogP | 4.15 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |