C27H21F4N3O4 — CID 155145800
(1R)-13-fluoro-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,12-triene-4-carboxamide (PubChem CID 155145800) has the molecular formula C27H21F4N3O4 and a molecular weight of 527.47 g/mol. Its IUPAC name is (1R)-13-fluoro-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,12-triene-4-carboxamide.
| Compound Name | (1R)-13-fluoro-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,12-triene-4-carboxamide |
|---|---|
| PubChem CID | 155145800 |
| Molecular Formula | C27H21F4N3O4 |
| Molecular Weight | 527.47 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | (1R)-13-fluoro-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,12-triene-4-carboxamide |
| SMILES | O=C(NCc1c(F)cc(F)cc1F)c1cn2c(c(OCc3ccccc3)c1=O)C(=O)N1CCC=C(F)[C@H]2C1 |
| InChI | InChI=1S/C27H21F4N3O4/c28-16-9-20(30)17(21(31)10-16)11-32-26(36)18-12-34-22-13-33(8-4-7-19(22)29)27(37)23(34)25(24(18)35)38-14-15-5-2-1-3-6-15/h1-3,5-7,9-10,12,22H,4,8,11,13-14H2,(H,32,36)/t22-/m1/s1 |
| InChIKey | XVHDKQXQTDHVFP-JOCHJYFZSA-N |
| XLogP | 4.03 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |