C30H29F3N4O5 — CID 170283690
(1S,10S,14Z)-10,15-dimethyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-13-oxa-2,9,14-triazatricyclo[7.7.1.02,7]heptadeca-3,6,14-triene-4-carboxamide (PubChem CID 170283690) has the molecular formula C30H29F3N4O5 and a molecular weight of 582.58 g/mol. Its IUPAC name is (1S,10S,14Z)-10,15-dimethyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-13-oxa-2,9,14-triazatricyclo[7.7.1.02,7]heptadeca-3,6,14-triene-4-carboxamide.
| Compound Name | (1S,10S,14Z)-10,15-dimethyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-13-oxa-2,9,14-triazatricyclo[7.7.1.02,7]heptadeca-3,6,14-triene-4-carboxamide |
|---|---|
| PubChem CID | 170283690 |
| Molecular Formula | C30H29F3N4O5 |
| Molecular Weight | 582.58 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | (1S,10S,14Z)-10,15-dimethyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-13-oxa-2,9,14-triazatricyclo[7.7.1.02,7]heptadeca-3,6,14-triene-4-carboxamide |
| SMILES | C/C1=N/OCC[C@H](C)N2C[C@H](C1)n1cc(C(=O)NCc3c(F)cc(F)cc3F)c(=O)c(OCc3ccccc3)c1C2=O |
| InChI | InChI=1S/C30H29F3N4O5/c1-17-10-21-14-36(18(2)8-9-42-35-17)30(40)26-28(41-16-19-6-4-3-5-7-19)27(38)23(15-37(21)26)29(39)34-13-22-24(32)11-20(31)12-25(22)33/h3-7,11-12,15,18,21H,8-10,13-14,16H2,1-2H3,(H,34,39)/b35-17-/t18-,21-/m0/s1 |
| InChIKey | SGLSSEFTKBLXOA-AZKRZNGISA-N |
| XLogP | 4.35 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |