C29H28F3N3O4 — CID 167047454
(1R,10S,13S)-13-hydroxy-10,13-dimethyl-8-oxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide (PubChem CID 167047454) has the molecular formula C29H28F3N3O4 and a molecular weight of 539.55 g/mol. Its IUPAC name is (1R,10S,13S)-13-hydroxy-10,13-dimethyl-8-oxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide.
| Compound Name | (1R,10S,13S)-13-hydroxy-10,13-dimethyl-8-oxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
|---|---|
| PubChem CID | 167047454 |
| Molecular Formula | C29H28F3N3O4 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | (1R,10S,13S)-13-hydroxy-10,13-dimethyl-8-oxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
| SMILES | C[C@H]1C=C[C@](C)(O)[C@H]2CN1C(=O)C1=C(OCc3ccccc3)CC(C(=O)NCc3c(F)cc(F)cc3F)=CN12 |
| InChI | InChI=1S/C29H28F3N3O4/c1-17-8-9-29(2,38)25-15-34(17)28(37)26-24(39-16-18-6-4-3-5-7-18)10-19(14-35(25)26)27(36)33-13-21-22(31)11-20(30)12-23(21)32/h3-9,11-12,14,17,25,38H,10,13,15-16H2,1-2H3,(H,33,36)/t17-,25+,29-/m0/s1 |
| InChIKey | YZMAHBOFSXSTTJ-NRMNNCMLSA-N |
| XLogP | 3.66 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|