C28H26F3N3O3 — CID 174304838
(1S,10S)-10-methyl-8-oxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide (PubChem CID 174304838) has the molecular formula C28H26F3N3O3 and a molecular weight of 509.53 g/mol. Its IUPAC name is (1S,10S)-10-methyl-8-oxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide.
| Compound Name | (1S,10S)-10-methyl-8-oxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
|---|---|
| PubChem CID | 174304838 |
| Molecular Formula | C28H26F3N3O3 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | (1S,10S)-10-methyl-8-oxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
| SMILES | C[C@H]1C=CC[C@H]2CN1C(=O)C1=C(OCc3ccccc3)CC(C(=O)NCc3c(F)cc(F)cc3F)=CN12 |
| InChI | InChI=1S/C28H26F3N3O3/c1-17-6-5-9-21-15-33(17)28(36)26-25(37-16-18-7-3-2-4-8-18)10-19(14-34(21)26)27(35)32-13-22-23(30)11-20(29)12-24(22)31/h2-8,11-12,14,17,21H,9-10,13,15-16H2,1H3,(H,32,35)/t17-,21-/m0/s1 |
| InChIKey | QEUCVILHIOPJCQ-UWJYYQICSA-N |
| XLogP | 4.30 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|