C29H29F3N4O4 — CID 170230888
(10S,11R,13R)-10,11,13-trimethyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide (PubChem CID 170230888) has the molecular formula C29H29F3N4O4 and a molecular weight of 554.57 g/mol. Its IUPAC name is (10S,11R,13R)-10,11,13-trimethyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide.
| Compound Name | (10S,11R,13R)-10,11,13-trimethyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 170230888 |
| Molecular Formula | C29H29F3N4O4 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | (10S,11R,13R)-10,11,13-trimethyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
| SMILES | C[C@@H]1C[C@@H](C)N2CN(C(=O)c3c(OCc4ccccc4)c(=O)c(C(=O)NCc4c(F)cc(F)cc4F)cn32)[C@H]1C |
| InChI | InChI=1S/C29H29F3N4O4/c1-16-9-17(2)36-15-34(18(16)3)29(39)25-27(40-14-19-7-5-4-6-8-19)26(37)22(13-35(25)36)28(38)33-12-21-23(31)10-20(30)11-24(21)32/h4-8,10-11,13,16-18H,9,12,14-15H2,1-3H3,(H,33,38)/t16-,17-,18+/m1/s1 |
| InChIKey | MUBMJCLJPPGBTK-KURKYZTESA-N |
| XLogP | 3.94 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |