C33H29F3N4O4 — CID 164590386
14-benzyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide (PubChem CID 164590386) has the molecular formula C33H29F3N4O4 and a molecular weight of 602.61 g/mol. Its IUPAC name is 14-benzyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide.
| Compound Name | 14-benzyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 164590386 |
| Molecular Formula | C33H29F3N4O4 |
| Molecular Weight | 602.61 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | 14-benzyl-5,8-dioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
| SMILES | O=C(NCc1c(F)cc(F)cc1F)c1cn2c(c(OCc3ccccc3)c1=O)C(=O)N1CCCCN2C1Cc1ccccc1 |
| InChI | InChI=1S/C33H29F3N4O4/c34-23-16-26(35)24(27(36)17-23)18-37-32(42)25-19-40-29(31(30(25)41)44-20-22-11-5-2-6-12-22)33(43)38-13-7-8-14-39(40)28(38)15-21-9-3-1-4-10-21/h1-6,9-12,16-17,19,28H,7-8,13-15,18,20H2,(H,37,42) |
| InChIKey | QMLUTKXOIKKSHK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.61 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |