C28H25F3N4O5 — CID 164928552
(10S,13R)-10,13-dimethyl-5,8,12-trioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide (PubChem CID 164928552) has the molecular formula C28H25F3N4O5 and a molecular weight of 554.53 g/mol. Its IUPAC name is (10S,13R)-10,13-dimethyl-5,8,12-trioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide.
| Compound Name | (10S,13R)-10,13-dimethyl-5,8,12-trioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 164928552 |
| Molecular Formula | C28H25F3N4O5 |
| Molecular Weight | 554.53 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | (10S,13R)-10,13-dimethyl-5,8,12-trioxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
| SMILES | C[C@@H]1C(=O)C[C@H](C)N2CN1n1cc(C(=O)NCc3c(F)cc(F)cc3F)c(=O)c(OCc3ccccc3)c1C2=O |
| InChI | InChI=1S/C28H25F3N4O5/c1-15-8-23(36)16(2)35-14-33(15)28(39)24-26(40-13-17-6-4-3-5-7-17)25(37)20(12-34(24)35)27(38)32-11-19-21(30)9-18(29)10-22(19)31/h3-7,9-10,12,15-16H,8,11,13-14H2,1-2H3,(H,32,38)/t15-,16+/m0/s1 |
| InChIKey | ZCADGZWWAFQUNQ-JKSUJKDBSA-N |
| XLogP | 2.88 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |