C29H27F3N4O6 — CID 174052697
(2R,6S)-2,6-dimethyl-8,10-dioxo-9-phenylmethoxy-11-[(2,4,6-trifluorophenyl)methylcarbamoyl]-2,3,6,7-tetrahydropyrido[1,2-b][1,2,5]triazecine-1-carboxylic acid (PubChem CID 174052697) has the molecular formula C29H27F3N4O6 and a molecular weight of 584.55 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-8,10-dioxo-9-phenylmethoxy-11-[(2,4,6-trifluorophenyl)methylcarbamoyl]-2,3,6,7-tetrahydropyrido[1,2-b][1,2,5]triazecine-1-carboxylic acid.
| Compound Name | (2R,6S)-2,6-dimethyl-8,10-dioxo-9-phenylmethoxy-11-[(2,4,6-trifluorophenyl)methylcarbamoyl]-2,3,6,7-tetrahydropyrido[1,2-b][1,2,5]triazecine-1-carboxylic acid |
|---|---|
| PubChem CID | 174052697 |
| Molecular Formula | C29H27F3N4O6 |
| Molecular Weight | 584.55 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-8,10-dioxo-9-phenylmethoxy-11-[(2,4,6-trifluorophenyl)methylcarbamoyl]-2,3,6,7-tetrahydropyrido[1,2-b][1,2,5]triazecine-1-carboxylic acid |
| SMILES | C[C@@H]1CC=C[C@H](C)NC(=O)c2c(OCc3ccccc3)c(=O)c(C(=O)NCc3c(F)cc(F)cc3F)cn2N1C(=O)O |
| InChI | InChI=1S/C29H27F3N4O6/c1-16-7-6-8-17(2)36(29(40)41)35-14-21(27(38)33-13-20-22(31)11-19(30)12-23(20)32)25(37)26(24(35)28(39)34-16)42-15-18-9-4-3-5-10-18/h3-7,9-12,14,16-17H,8,13,15H2,1-2H3,(H,33,38)(H,34,39)(H,40,41)/t16-,17+/m0/s1 |
| InChIKey | VVPOWTJTMGORGQ-DLBZAZTESA-N |
| XLogP | 3.86 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|