C29H29F3N4O4 — CID 164590657
(3Z)-2-ethyl-5,6-dimethyl-7,9-dioxo-8-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,5-dihydro-1H-pyrido[1,2-b][1,2,5]triazonine-10-carboxamide (PubChem CID 164590657) has the molecular formula C29H29F3N4O4 and a molecular weight of 554.57 g/mol. Its IUPAC name is (3Z)-2-ethyl-5,6-dimethyl-7,9-dioxo-8-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,5-dihydro-1H-pyrido[1,2-b][1,2,5]triazonine-10-carboxamide.
| Compound Name | (3Z)-2-ethyl-5,6-dimethyl-7,9-dioxo-8-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,5-dihydro-1H-pyrido[1,2-b][1,2,5]triazonine-10-carboxamide |
|---|---|
| PubChem CID | 164590657 |
| Molecular Formula | C29H29F3N4O4 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | (3Z)-2-ethyl-5,6-dimethyl-7,9-dioxo-8-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-2,5-dihydro-1H-pyrido[1,2-b][1,2,5]triazonine-10-carboxamide |
| SMILES | CCC1/C=C\C(C)N(C)C(=O)c2c(OCc3ccccc3)c(=O)c(C(=O)NCc3c(F)cc(F)cc3F)cn2N1 |
| InChI | InChI=1S/C29H29F3N4O4/c1-4-20-11-10-17(2)35(3)29(39)25-27(40-16-18-8-6-5-7-9-18)26(37)22(15-36(25)34-20)28(38)33-14-21-23(31)12-19(30)13-24(21)32/h5-13,15,17,20,34H,4,14,16H2,1-3H3,(H,33,38)/b11-10- |
| InChIKey | LRDAVIQLUSBMJH-KHPPLWFESA-N |
| XLogP | 4.13 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|