C29H28F3N3O5 — CID 163235291
6-formyl-1-(4-hydroxy-1,7-dimethyl-2,3,4,7-tetrahydroazepin-3-yl)-4-oxo-5-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]pyridine-3-carboxamide (PubChem CID 163235291) has the molecular formula C29H28F3N3O5 and a molecular weight of 555.55 g/mol. Its IUPAC name is 6-formyl-1-(4-hydroxy-1,7-dimethyl-2,3,4,7-tetrahydroazepin-3-yl)-4-oxo-5-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]pyridine-3-carboxamide.
| Compound Name | 6-formyl-1-(4-hydroxy-1,7-dimethyl-2,3,4,7-tetrahydroazepin-3-yl)-4-oxo-5-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163235291 |
| Molecular Formula | C29H28F3N3O5 |
| Molecular Weight | 555.55 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | 6-formyl-1-(4-hydroxy-1,7-dimethyl-2,3,4,7-tetrahydroazepin-3-yl)-4-oxo-5-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]pyridine-3-carboxamide |
| SMILES | CC1C=CC(O)C(n2cc(C(=O)NCc3c(F)cc(F)cc3F)c(=O)c(OCc3ccccc3)c2C=O)CN1C |
| InChI | InChI=1S/C29H28F3N3O5/c1-17-8-9-26(37)24(14-34(17)2)35-13-21(29(39)33-12-20-22(31)10-19(30)11-23(20)32)27(38)28(25(35)15-36)40-16-18-6-4-3-5-7-18/h3-11,13,15,17,24,26,37H,12,14,16H2,1-2H3,(H,33,39) |
| InChIKey | OLBCDLTWQSBWME-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|